About 2-pentoxypyridin-3-amine
2-pentoxypyridin-3-amine (PubChem CID 43274913) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-pentoxypyridin-3-amine.
Molecular Properties
| Compound Name | 2-pentoxypyridin-3-amine |
| PubChem CID | 43274913 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-pentoxypyridin-3-amine |
| SMILES | CCCCCOc1ncccc1N |
| InChI | InChI=1S/C10H16N2O/c1-2-3-4-8-13-10-9(11)6-5-7-12-10/h5-7H,2-4,8,11H2,1H3 |
| InChIKey | ISRIEFIWRBCRCN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxypyridin-3-amine?
The IUPAC name of 2-pentoxypyridin-3-amine (CID 43274913) is 2-pentoxypyridin-3-amine.
What is the SMILES notation for 2-pentoxypyridin-3-amine?
The canonical SMILES for 2-pentoxypyridin-3-amine is CCCCCOc1ncccc1N.
What is the InChIKey of 2-pentoxypyridin-3-amine?
The InChIKey is ISRIEFIWRBCRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-4-8-13-10-9(11)6-5-7-12-10/h5-7H,2-4,8,11H2,1H3.
What are the key properties of 2-pentoxypyridin-3-amine?
2-pentoxypyridin-3-amine has a molecular weight of 180.25 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxypyridin-3-amine is sourced from PubChem (CID 43274913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).