C12H18N2O3 — CID 43276291
2-[4-methoxy-2-(methylaminomethyl)phenoxy]-N-methylacetamide (PubChem CID 43276291) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[4-methoxy-2-(methylaminomethyl)phenoxy]-N-methylacetamide.
| Compound Name | 2-[4-methoxy-2-(methylaminomethyl)phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 43276291 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-[4-methoxy-2-(methylaminomethyl)phenoxy]-N-methylacetamide |
| SMILES | CNCc1cc(OC)ccc1OCC(=O)NC |
| InChI | InChI=1S/C12H18N2O3/c1-13-7-9-6-10(16-3)4-5-11(9)17-8-12(15)14-2/h4-6,13H,7-8H2,1-3H3,(H,14,15) |
| InChIKey | IISLMOHEWZTJKI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |