C19H25NO — CID 43276733
N-[[3,5-dimethyl-4-(2-phenylethoxy)phenyl]methyl]ethanamine (PubChem CID 43276733) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is N-[[3,5-dimethyl-4-(2-phenylethoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dimethyl-4-(2-phenylethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 43276733 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-[[3,5-dimethyl-4-(2-phenylethoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(C)c(OCCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H25NO/c1-4-20-14-18-12-15(2)19(16(3)13-18)21-11-10-17-8-6-5-7-9-17/h5-9,12-13,20H,4,10-11,14H2,1-3H3 |
| InChIKey | VMFAGSDEYMRZCA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |