C12H19BrN2 — CID 43280334
5-bromo-N,N-diethyl-2-(methylaminomethyl)aniline (PubChem CID 43280334) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 5-bromo-N,N-diethyl-2-(methylaminomethyl)aniline.
| Compound Name | 5-bromo-N,N-diethyl-2-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 43280334 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-bromo-N,N-diethyl-2-(methylaminomethyl)aniline |
| SMILES | CCN(CC)c1cc(Br)ccc1CNC |
| InChI | InChI=1S/C12H19BrN2/c1-4-15(5-2)12-8-11(13)7-6-10(12)9-14-3/h6-8,14H,4-5,9H2,1-3H3 |
| InChIKey | JCHGKACKLCYLEK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |