C14H28N4 — CID 43280698
N-butyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine (PubChem CID 43280698) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-butyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine.
| Compound Name | N-butyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43280698 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-butyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine |
| SMILES | CCCCN(C)c1c(CNCCC)c(C)nn1C |
| InChI | InChI=1S/C14H28N4/c1-6-8-10-17(4)14-13(11-15-9-7-2)12(3)16-18(14)5/h15H,6-11H2,1-5H3 |
| InChIKey | CMUYTSSLLZWXHH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|