C13H22N2 — CID 43280883
2-(ethylaminomethyl)-N-methyl-N-propan-2-ylaniline (PubChem CID 43280883) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-N-methyl-N-propan-2-ylaniline.
| Compound Name | 2-(ethylaminomethyl)-N-methyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 43280883 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-(ethylaminomethyl)-N-methyl-N-propan-2-ylaniline |
| SMILES | CCNCc1ccccc1N(C)C(C)C |
| InChI | InChI=1S/C13H22N2/c1-5-14-10-12-8-6-7-9-13(12)15(4)11(2)3/h6-9,11,14H,5,10H2,1-4H3 |
| InChIKey | IVEWSSSPMUMLEX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |