About [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol
[1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol (PubChem CID 43281527) has the molecular formula C15H28N4O
and a molecular weight of 280.42 g/mol. Its IUPAC name is [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol |
| PubChem CID | 43281527 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol |
| SMILES | CCCNCc1c(C)nn(C)c1N1CCC(CO)CC1 |
| InChI | InChI=1S/C15H28N4O/c1-4-7-16-10-14-12(2)17-18(3)15(14)19-8-5-13(11-20)6-9-19/h13,16,20H,4-11H2,1-3H3 |
| InChIKey | BHDVPHWANOVLTG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol?
The IUPAC name of [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol (CID 43281527) is [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol is CCCNCc1c(C)nn(C)c1N1CCC(CO)CC1.
What is the InChIKey of [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol?
The InChIKey is BHDVPHWANOVLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O/c1-4-7-16-10-14-12(2)17-18(3)15(14)19-8-5-13(11-20)6-9-19/h13,16,20H,4-11H2,1-3H3.
What are the key properties of [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol?
[1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol has a molecular weight of 280.42 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]piperidin-4-yl]methanol is sourced from PubChem (CID 43281527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).