C13H21BrN2 — CID 43281562
5-bromo-N-ethyl-N-methyl-2-[(propan-2-ylamino)methyl]aniline (PubChem CID 43281562) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 5-bromo-N-ethyl-N-methyl-2-[(propan-2-ylamino)methyl]aniline.
| Compound Name | 5-bromo-N-ethyl-N-methyl-2-[(propan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 43281562 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-bromo-N-ethyl-N-methyl-2-[(propan-2-ylamino)methyl]aniline |
| SMILES | CCN(C)c1cc(Br)ccc1CNC(C)C |
| InChI | InChI=1S/C13H21BrN2/c1-5-16(4)13-8-12(14)7-6-11(13)9-15-10(2)3/h6-8,10,15H,5,9H2,1-4H3 |
| InChIKey | SEVWBAZEIIXTTR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |