C16H19NO — CID 43282630
1-[2-(2,6-dimethylphenoxy)phenyl]-N-methylmethanamine (PubChem CID 43282630) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(2,6-dimethylphenoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 43282630 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccccc1Oc1c(C)cccc1C |
| InChI | InChI=1S/C16H19NO/c1-12-7-6-8-13(2)16(12)18-15-10-5-4-9-14(15)11-17-3/h4-10,17H,11H2,1-3H3 |
| InChIKey | DHYYGCHSAHTIEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |