C18H22BrNO — CID 43282741
N-[[4-bromo-2-(3-propan-2-ylphenoxy)phenyl]methyl]ethanamine (PubChem CID 43282741) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is N-[[4-bromo-2-(3-propan-2-ylphenoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[4-bromo-2-(3-propan-2-ylphenoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 43282741 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[[4-bromo-2-(3-propan-2-ylphenoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(Br)cc1Oc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C18H22BrNO/c1-4-20-12-15-8-9-16(19)11-18(15)21-17-7-5-6-14(10-17)13(2)3/h5-11,13,20H,4,12H2,1-3H3 |
| InChIKey | AKBNQJQEUJTWSG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |