C17H20ClNO — CID 43283414
N-[[2-(4-chloro-2-methylphenoxy)phenyl]methyl]propan-1-amine (PubChem CID 43283414) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is N-[[2-(4-chloro-2-methylphenoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-chloro-2-methylphenoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43283414 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[[2-(4-chloro-2-methylphenoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccccc1Oc1ccc(Cl)cc1C |
| InChI | InChI=1S/C17H20ClNO/c1-3-10-19-12-14-6-4-5-7-17(14)20-16-9-8-15(18)11-13(16)2/h4-9,11,19H,3,10,12H2,1-2H3 |
| InChIKey | OIXGYRRTEZYADT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|