C8H6N2OS — CID 43286791
4-pyridin-2-yl-3H-1,3-thiazol-2-one (PubChem CID 43286791) has the molecular formula C8H6N2OS and a molecular weight of 178.22 g/mol. Its IUPAC name is 4-pyridin-2-yl-3H-1,3-thiazol-2-one.
| Compound Name | 4-pyridin-2-yl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 43286791 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 4-pyridin-2-yl-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2ccccn2)cs1 |
| InChI | InChI=1S/C8H6N2OS/c11-8-10-7(5-12-8)6-3-1-2-4-9-6/h1-5H,(H,10,11) |
| InChIKey | BTIRGDFIZZGHDN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |