About 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one
3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one (PubChem CID 43286828) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one.
Analyze 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one (CID 43286828) is 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one is Cc1csc(=O)n1CC(O)CN.
What is the InChIKey of 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The InChIKey is FGOZKKOJEQBYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-5-4-12-7(11)9(5)3-6(10)2-8/h4,6,10H,2-3,8H2,1H3.
What are the key properties of 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one?
3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one has a molecular weight of 188.25 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-2-hydroxypropyl)-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 43286828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).