C12H14N2O2S — CID 43287026
3-[(3-amino-4-methoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 43287026) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-[(3-amino-4-methoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-one.
| Compound Name | 3-[(3-amino-4-methoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 43287026 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-[(3-amino-4-methoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | COc1ccc(Cn2c(C)csc2=O)cc1N |
| InChI | InChI=1S/C12H14N2O2S/c1-8-7-17-12(15)14(8)6-9-3-4-11(16-2)10(13)5-9/h3-5,7H,6,13H2,1-2H3 |
| InChIKey | OGFVSWSWXCPTGH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|