About 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide (PubChem CID 43287100) has the molecular formula C7H10N2OS2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide.
Molecular Properties
| Compound Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide |
| PubChem CID | 43287100 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide |
| SMILES | Cc1csc(=O)n1CCC(N)=S |
| InChI | InChI=1S/C7H10N2OS2/c1-5-4-12-7(10)9(5)3-2-6(8)11/h4H,2-3H2,1H3,(H2,8,11) |
| InChIKey | OYEQDROZBADARV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide?
The IUPAC name of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide (CID 43287100) is 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide.
What is the SMILES notation for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide?
The canonical SMILES for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide is Cc1csc(=O)n1CCC(N)=S.
What is the InChIKey of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide?
The InChIKey is OYEQDROZBADARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS2/c1-5-4-12-7(10)9(5)3-2-6(8)11/h4H,2-3H2,1H3,(H2,8,11).
What are the key properties of 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide?
3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide has a molecular weight of 202.30 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanethioamide is sourced from PubChem (CID 43287100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).