C16H20INS — CID 43288049
N-ethyl-1-[5-(2-iodophenyl)thiophen-2-yl]butan-1-amine (PubChem CID 43288049) has the molecular formula C16H20INS and a molecular weight of 385.31 g/mol. Its IUPAC name is N-ethyl-1-[5-(2-iodophenyl)thiophen-2-yl]butan-1-amine.
| Compound Name | N-ethyl-1-[5-(2-iodophenyl)thiophen-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 43288049 |
| Molecular Formula | C16H20INS |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-ethyl-1-[5-(2-iodophenyl)thiophen-2-yl]butan-1-amine |
| SMILES | CCCC(NCC)c1ccc(-c2ccccc2I)s1 |
| InChI | InChI=1S/C16H20INS/c1-3-7-14(18-4-2)16-11-10-15(19-16)12-8-5-6-9-13(12)17/h5-6,8-11,14,18H,3-4,7H2,1-2H3 |
| InChIKey | NYNRNZXEUVZNKE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|