About N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide
N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide (PubChem CID 43289145) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide |
| PubChem CID | 43289145 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide |
| SMILES | Cc1cc(C)n(CCC(=O)N(C)CCC#N)c(=O)n1 |
| InChI | InChI=1S/C13H18N4O2/c1-10-9-11(2)17(13(19)15-10)8-5-12(18)16(3)7-4-6-14/h9H,4-5,7-8H2,1-3H3 |
| InChIKey | ABQBYMDQZFJNDM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide?
The IUPAC name of N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide (CID 43289145) is N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide.
What is the SMILES notation for N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide?
The canonical SMILES for N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide is Cc1cc(C)n(CCC(=O)N(C)CCC#N)c(=O)n1.
What is the InChIKey of N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide?
The InChIKey is ABQBYMDQZFJNDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c1-10-9-11(2)17(13(19)15-10)8-5-12(18)16(3)7-4-6-14/h9H,4-5,7-8H2,1-3H3.
What are the key properties of N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide?
N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide has a molecular weight of 262.31 g/mol, XLogP of 0.62, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-methylpropanamide is sourced from PubChem (CID 43289145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).