C10H16F4N2O2S — CID 43291424
N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanamide (PubChem CID 43291424) has the molecular formula C10H16F4N2O2S and a molecular weight of 304.31 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 43291424 |
| Molecular Formula | C10H16F4N2O2S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O2S/c1-16(4-2-7(15)19)8(17)3-5-18-6-10(13,14)9(11)12/h9H,2-6H2,1H3,(H2,15,19) |
| InChIKey | OPUYMBBVEAPXPS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|