C16H20N2 — CID 43291742
2-(3,4-dihydro-2H-quinolin-1-yl)cyclohexane-1-carbonitrile (PubChem CID 43291742) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)cyclohexane-1-carbonitrile.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 43291742 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCCCC1N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H20N2/c17-12-14-7-2-4-10-16(14)18-11-5-8-13-6-1-3-9-15(13)18/h1,3,6,9,14,16H,2,4-5,7-8,10-11H2 |
| InChIKey | HDWFSPQVUCLRKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |