About 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile
4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile (PubChem CID 43292106) has the molecular formula C13H20F3NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile |
| PubChem CID | 43292106 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile |
| SMILES | CC(C)(C)C1CCC(C#N)C(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3NO/c1-12(2,3)10-5-4-9(7-17)11(6-10)18-8-13(14,15)16/h9-11H,4-6,8H2,1-3H3 |
| InChIKey | XZBDQYSJTFOZBV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile?
The IUPAC name of 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile (CID 43292106) is 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile.
What is the SMILES notation for 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile?
The canonical SMILES for 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile is CC(C)(C)C1CCC(C#N)C(OCC(F)(F)F)C1.
What is the InChIKey of 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile?
The InChIKey is XZBDQYSJTFOZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3NO/c1-12(2,3)10-5-4-9(7-17)11(6-10)18-8-13(14,15)16/h9-11H,4-6,8H2,1-3H3.
What are the key properties of 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile?
4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile has a molecular weight of 263.30 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(2,2,2-trifluoroethoxy)cyclohexane-1-carbonitrile is sourced from PubChem (CID 43292106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).