C15H23F4NO — CID 43292792
4-(2-methylbutan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)cyclohexane-1-carbonitrile (PubChem CID 43292792) has the molecular formula C15H23F4NO and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)cyclohexane-1-carbonitrile.
| Compound Name | 4-(2-methylbutan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 43292792 |
| Molecular Formula | C15H23F4NO |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)cyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(OCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C15H23F4NO/c1-4-14(2,3)11-6-5-10(8-20)12(7-11)21-9-15(18,19)13(16)17/h10-13H,4-7,9H2,1-3H3 |
| InChIKey | OOKSZLHQWNVLNG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|