C12H12N2O4S — CID 43294353
5-methyl-2-(1H-pyrrol-3-ylsulfonylamino)benzoic acid (PubChem CID 43294353) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 5-methyl-2-(1H-pyrrol-3-ylsulfonylamino)benzoic acid.
| Compound Name | 5-methyl-2-(1H-pyrrol-3-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 43294353 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-methyl-2-(1H-pyrrol-3-ylsulfonylamino)benzoic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc[nH]c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O4S/c1-8-2-3-11(10(6-8)12(15)16)14-19(17,18)9-4-5-13-7-9/h2-7,13-14H,1H3,(H,15,16) |
| InChIKey | BELVGPZJXZKKLD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |