C18H26N2 — CID 43294791
N'-methyl-1-naphthalen-1-yl-N'-pentylethane-1,2-diamine (PubChem CID 43294791) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N'-methyl-1-naphthalen-1-yl-N'-pentylethane-1,2-diamine.
| Compound Name | N'-methyl-1-naphthalen-1-yl-N'-pentylethane-1,2-diamine |
|---|---|
| PubChem CID | 43294791 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N'-methyl-1-naphthalen-1-yl-N'-pentylethane-1,2-diamine |
| SMILES | CCCCCN(C)CC(N)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H26N2/c1-3-4-7-13-20(2)14-18(19)17-12-8-10-15-9-5-6-11-16(15)17/h5-6,8-12,18H,3-4,7,13-14,19H2,1-2H3 |
| InChIKey | RKFPIXRNBUEACT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|