N-methyl-N-(2-methylbutyl)sulfamoyl chloride

C6H14ClNO2S — CID 43295660

IUPACN-methyl-N-(2-methylbutyl)sulfamoyl chloride
SMILESCCC(C)CN(C)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-4-6(2)5-8(3)11(7,9)10/h6H,4-5H2,1-3H3
InChIKeyNPPNFDTWKWJYJP-UHFFFAOYSA-N
MW199.70 g/mol
LogP1.45
Rot. Bonds4

About N-methyl-N-(2-methylbutyl)sulfamoyl chloride

N-methyl-N-(2-methylbutyl)sulfamoyl chloride (PubChem CID 43295660) has the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. Its IUPAC name is N-methyl-N-(2-methylbutyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-methyl-N-(2-methylbutyl)sulfamoyl chloride
PubChem CID43295660
Molecular FormulaC6H14ClNO2S
Molecular Weight199.70 g/mol
Exact Mass199.04
IUPAC NameN-methyl-N-(2-methylbutyl)sulfamoyl chloride
SMILESCCC(C)CN(C)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-4-6(2)5-8(3)11(7,9)10/h6H,4-5H2,1-3H3
InChIKeyNPPNFDTWKWJYJP-UHFFFAOYSA-N
XLogP1.45
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.70
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-methyl-N-(2-methylbutyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-N-(2-methylbutyl)sulfamoyl chloride?
The IUPAC name of N-methyl-N-(2-methylbutyl)sulfamoyl chloride (CID 43295660) is N-methyl-N-(2-methylbutyl)sulfamoyl chloride.
What is the SMILES notation for N-methyl-N-(2-methylbutyl)sulfamoyl chloride?
The canonical SMILES for N-methyl-N-(2-methylbutyl)sulfamoyl chloride is CCC(C)CN(C)S(=O)(=O)Cl.
What is the InChIKey of N-methyl-N-(2-methylbutyl)sulfamoyl chloride?
The InChIKey is NPPNFDTWKWJYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClNO2S/c1-4-6(2)5-8(3)11(7,9)10/h6H,4-5H2,1-3H3.
What are the key properties of N-methyl-N-(2-methylbutyl)sulfamoyl chloride?
N-methyl-N-(2-methylbutyl)sulfamoyl chloride has a molecular weight of 199.70 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(2-methylbutyl)sulfamoyl chloride is sourced from PubChem (CID 43295660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).