C10H22N2S — CID 43296809
1-N,3-dimethyl-1-N-(thiolan-3-yl)butane-1,2-diamine (PubChem CID 43296809) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is 1-N,3-dimethyl-1-N-(thiolan-3-yl)butane-1,2-diamine.
| Compound Name | 1-N,3-dimethyl-1-N-(thiolan-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 43296809 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-N,3-dimethyl-1-N-(thiolan-3-yl)butane-1,2-diamine |
| SMILES | CC(C)C(N)CN(C)C1CCSC1 |
| InChI | InChI=1S/C10H22N2S/c1-8(2)10(11)6-12(3)9-4-5-13-7-9/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | RBRUEMPYYLIPHX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |