C13H16N4OS — CID 43299294
2-(4-aminophenyl)sulfanyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)acetamide (PubChem CID 43299294) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)acetamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 43299294 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)acetamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CSc1ccc(N)cc1 |
| InChI | InChI=1S/C13H16N4OS/c1-8-13(9(2)17-16-8)15-12(18)7-19-11-5-3-10(14)4-6-11/h3-6H,7,14H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | YBWWLAVIKRWPTA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|