C14H13Cl2N3OS — CID 43300903
3-[(5-amino-2-pyridinyl)sulfanyl]-N-(2,6-dichlorophenyl)propanamide (PubChem CID 43300903) has the molecular formula C14H13Cl2N3OS and a molecular weight of 342.25 g/mol. Its IUPAC name is 3-[(5-amino-2-pyridinyl)sulfanyl]-N-(2,6-dichlorophenyl)propanamide.
| Compound Name | 3-[(5-amino-2-pyridinyl)sulfanyl]-N-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 43300903 |
| Molecular Formula | C14H13Cl2N3OS |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-[(5-amino-2-pyridinyl)sulfanyl]-N-(2,6-dichlorophenyl)propanamide |
| SMILES | Nc1ccc(SCCC(=O)Nc2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C14H13Cl2N3OS/c15-10-2-1-3-11(16)14(10)19-12(20)6-7-21-13-5-4-9(17)8-18-13/h1-5,8H,6-7,17H2,(H,19,20) |
| InChIKey | MFKYIOFTVBRZPK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |