C17H20N2OS — CID 43302578
2-(2-amino-4-methylphenyl)sulfanyl-N-(2,5-dimethylphenyl)acetamide (PubChem CID 43302578) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-(2-amino-4-methylphenyl)sulfanyl-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(2-amino-4-methylphenyl)sulfanyl-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 43302578 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(2-amino-4-methylphenyl)sulfanyl-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2cc(C)ccc2C)c(N)c1 |
| InChI | InChI=1S/C17H20N2OS/c1-11-5-7-16(14(18)8-11)21-10-17(20)19-15-9-12(2)4-6-13(15)3/h4-9H,10,18H2,1-3H3,(H,19,20) |
| InChIKey | DEIRUGXOGXUYPC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|