C13H12FNO3S — CID 43303409
methyl 5-[(4-amino-2-fluorophenyl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 43303409) has the molecular formula C13H12FNO3S and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 5-[(4-amino-2-fluorophenyl)sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(4-amino-2-fluorophenyl)sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43303409 |
| Molecular Formula | C13H12FNO3S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 5-[(4-amino-2-fluorophenyl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CSc2ccc(N)cc2F)o1 |
| InChI | InChI=1S/C13H12FNO3S/c1-17-13(16)11-4-3-9(18-11)7-19-12-5-2-8(15)6-10(12)14/h2-6H,7,15H2,1H3 |
| InChIKey | UTDSQRMHXATCBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|