C12H15FN6S — CID 43303485
6-[(4-amino-2-fluorophenyl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 43303485) has the molecular formula C12H15FN6S and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-[(4-amino-2-fluorophenyl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-amino-2-fluorophenyl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 43303485 |
| Molecular Formula | C12H15FN6S |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-[(4-amino-2-fluorophenyl)sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(CSc2ccc(N)cc2F)n1 |
| InChI | InChI=1S/C12H15FN6S/c1-19(2)12-17-10(16-11(15)18-12)6-20-9-4-3-7(14)5-8(9)13/h3-5H,6,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | DGNZPWDTAMVXNY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|