C14H14FNO3S — CID 43303959
methyl 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylate (PubChem CID 43303959) has the molecular formula C14H14FNO3S and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43303959 |
| Molecular Formula | C14H14FNO3S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | methyl 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CSc2ccc(F)cc2N)oc1C |
| InChI | InChI=1S/C14H14FNO3S/c1-8-11(14(17)18-2)6-10(19-8)7-20-13-4-3-9(15)5-12(13)16/h3-6H,7,16H2,1-2H3 |
| InChIKey | UDSPYVNCKJINLJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|