C14H13FN4OS — CID 43303990
2-[2-(2-amino-4-fluorophenyl)sulfanylethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 43303990) has the molecular formula C14H13FN4OS and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-(2-amino-4-fluorophenyl)sulfanylethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-(2-amino-4-fluorophenyl)sulfanylethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 43303990 |
| Molecular Formula | C14H13FN4OS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[2-(2-amino-4-fluorophenyl)sulfanylethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Nc1cc(F)ccc1SCCn1nc2ccccn2c1=O |
| InChI | InChI=1S/C14H13FN4OS/c15-10-4-5-12(11(16)9-10)21-8-7-19-14(20)18-6-2-1-3-13(18)17-19/h1-6,9H,7-8,16H2 |
| InChIKey | BPQPREUKYIRJTD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|