C12H9FN4OS2 — CID 43304115
7-[(2-amino-4-fluorophenyl)sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 43304115) has the molecular formula C12H9FN4OS2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 7-[(2-amino-4-fluorophenyl)sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(2-amino-4-fluorophenyl)sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 43304115 |
| Molecular Formula | C12H9FN4OS2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 7-[(2-amino-4-fluorophenyl)sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Nc1cc(F)ccc1SCc1cc(=O)n2ncsc2n1 |
| InChI | InChI=1S/C12H9FN4OS2/c13-7-1-2-10(9(14)3-7)19-5-8-4-11(18)17-12(16-8)20-6-15-17/h1-4,6H,5,14H2 |
| InChIKey | QBSUIRABHWOBOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|