About 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide
2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide (PubChem CID 43304140) has the molecular formula C16H25FN2OS
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide |
| PubChem CID | 43304140 |
| Molecular Formula | C16H25FN2OS |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CSc1ccc(F)cc1N |
| InChI | InChI=1S/C16H25FN2OS/c1-3-5-9-19(10-6-4-2)16(20)12-21-15-8-7-13(17)11-14(15)18/h7-8,11H,3-6,9-10,12,18H2,1-2H3 |
| InChIKey | OELOOJJPODCXRP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide?
The IUPAC name of 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide (CID 43304140) is 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide.
What is the SMILES notation for 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide?
The canonical SMILES for 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide is CCCCN(CCCC)C(=O)CSc1ccc(F)cc1N.
What is the InChIKey of 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide?
The InChIKey is OELOOJJPODCXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN2OS/c1-3-5-9-19(10-6-4-2)16(20)12-21-15-8-7-13(17)11-14(15)18/h7-8,11H,3-6,9-10,12,18H2,1-2H3.
What are the key properties of 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide?
2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide has a molecular weight of 312.45 g/mol, XLogP of 3.93, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-fluorophenyl)sulfanyl-N,N-dibutylacetamide is sourced from PubChem (CID 43304140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).