C13H11FN2O3S — CID 43304156
N-[2-(2-amino-4-fluorophenyl)sulfanylacetyl]furan-2-carboxamide (PubChem CID 43304156) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[2-(2-amino-4-fluorophenyl)sulfanylacetyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-amino-4-fluorophenyl)sulfanylacetyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43304156 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N-[2-(2-amino-4-fluorophenyl)sulfanylacetyl]furan-2-carboxamide |
| SMILES | Nc1cc(F)ccc1SCC(=O)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H11FN2O3S/c14-8-3-4-11(9(15)6-8)20-7-12(17)16-13(18)10-2-1-5-19-10/h1-6H,7,15H2,(H,16,17,18) |
| InChIKey | CBZXFJRFLLJNIY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|