C14H17ClN2S2 — CID 43304515
2-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]-3-chloroaniline (PubChem CID 43304515) has the molecular formula C14H17ClN2S2 and a molecular weight of 312.89 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]-3-chloroaniline.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]-3-chloroaniline |
|---|---|
| PubChem CID | 43304515 |
| Molecular Formula | C14H17ClN2S2 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]-3-chloroaniline |
| SMILES | CC(C)(C)c1nc(CSc2c(N)cccc2Cl)cs1 |
| InChI | InChI=1S/C14H17ClN2S2/c1-14(2,3)13-17-9(8-19-13)7-18-12-10(15)5-4-6-11(12)16/h4-6,8H,7,16H2,1-3H3 |
| InChIKey | VTKYRMRZSDUMRB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|