C14H12BrClN2OS — CID 43304961
2-(2-amino-6-chlorophenyl)sulfanyl-N-(4-bromophenyl)acetamide (PubChem CID 43304961) has the molecular formula C14H12BrClN2OS and a molecular weight of 371.69 g/mol. Its IUPAC name is 2-(2-amino-6-chlorophenyl)sulfanyl-N-(4-bromophenyl)acetamide.
| Compound Name | 2-(2-amino-6-chlorophenyl)sulfanyl-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 43304961 |
| Molecular Formula | C14H12BrClN2OS |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 2-(2-amino-6-chlorophenyl)sulfanyl-N-(4-bromophenyl)acetamide |
| SMILES | Nc1cccc(Cl)c1SCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrClN2OS/c15-9-4-6-10(7-5-9)18-13(19)8-20-14-11(16)2-1-3-12(14)17/h1-7H,8,17H2,(H,18,19) |
| InChIKey | KVJKIHSMCFAGOF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|