C14H9F3N2S — CID 43306651
5-methyl-N-(2,3,4-trifluorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 43306651) has the molecular formula C14H9F3N2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-methyl-N-(2,3,4-trifluorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-methyl-N-(2,3,4-trifluorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43306651 |
| Molecular Formula | C14H9F3N2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-methyl-N-(2,3,4-trifluorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2sc(Nc3ccc(F)c(F)c3F)nc2c1 |
| InChI | InChI=1S/C14H9F3N2S/c1-7-2-5-11-10(6-7)19-14(20-11)18-9-4-3-8(15)12(16)13(9)17/h2-6H,1H3,(H,18,19) |
| InChIKey | WGOCBHKZQAKLEC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|