About 2-methylfuran-3-carbonyl azide
2-methylfuran-3-carbonyl azide (PubChem CID 43307136) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 2-methylfuran-3-carbonyl azide.
Molecular Properties
| Compound Name | 2-methylfuran-3-carbonyl azide |
| PubChem CID | 43307136 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 2-methylfuran-3-carbonyl azide |
| SMILES | Cc1occc1C(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C6H5N3O2/c1-4-5(2-3-11-4)6(10)8-9-7/h2-3H,1H3 |
| InChIKey | CYZBFSKLQCMYJC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methylfuran-3-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylfuran-3-carbonyl azide?
The IUPAC name of 2-methylfuran-3-carbonyl azide (CID 43307136) is 2-methylfuran-3-carbonyl azide.
What is the SMILES notation for 2-methylfuran-3-carbonyl azide?
The canonical SMILES for 2-methylfuran-3-carbonyl azide is Cc1occc1C(=O)N=[N+]=[N-].
What is the InChIKey of 2-methylfuran-3-carbonyl azide?
The InChIKey is CYZBFSKLQCMYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c1-4-5(2-3-11-4)6(10)8-9-7/h2-3H,1H3.
What are the key properties of 2-methylfuran-3-carbonyl azide?
2-methylfuran-3-carbonyl azide has a molecular weight of 151.12 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylfuran-3-carbonyl azide is sourced from PubChem (CID 43307136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).