C11H16N2O2 — CID 43309364
propyl N-[3-(aminomethyl)phenyl]carbamate (PubChem CID 43309364) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is propyl N-[3-(aminomethyl)phenyl]carbamate.
| Compound Name | propyl N-[3-(aminomethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 43309364 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | propyl N-[3-(aminomethyl)phenyl]carbamate |
| SMILES | CCCOC(=O)Nc1cccc(CN)c1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-6-15-11(14)13-10-5-3-4-9(7-10)8-12/h3-5,7H,2,6,8,12H2,1H3,(H,13,14) |
| InChIKey | DZMCXGWXNFUUQS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |