About 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide
2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide (PubChem CID 43310852) has the molecular formula C12H14ClN3O2
and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide |
| PubChem CID | 43310852 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNC1C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClN3O2/c1-16(2)10(17)6-14-11-8-5-7(13)3-4-9(8)15-12(11)18/h3-5,11,14H,6H2,1-2H3,(H,15,18) |
| InChIKey | MTLWEIUKRBAHMA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide (CID 43310852) is 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide is CN(C)C(=O)CNC1C(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide?
The InChIKey is MTLWEIUKRBAHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O2/c1-16(2)10(17)6-14-11-8-5-7(13)3-4-9(8)15-12(11)18/h3-5,11,14H,6H2,1-2H3,(H,15,18).
What are the key properties of 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide?
2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide has a molecular weight of 267.72 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-2-oxo-1,3-dihydroindol-3-yl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 43310852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).