C15H18N2O2 — CID 43310908
2-[(2-hydroxynaphthalen-1-yl)methylamino]-N,N-dimethylacetamide (PubChem CID 43310908) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[(2-hydroxynaphthalen-1-yl)methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2-hydroxynaphthalen-1-yl)methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43310908 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[(2-hydroxynaphthalen-1-yl)methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNCc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C15H18N2O2/c1-17(2)15(19)10-16-9-13-12-6-4-3-5-11(12)7-8-14(13)18/h3-8,16,18H,9-10H2,1-2H3 |
| InChIKey | TWYQKALKKRZAJU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|