About 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide
2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide (PubChem CID 43311080) has the molecular formula C11H12ClN3OS
and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide |
| PubChem CID | 43311080 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-15(2)9(16)6-13-11-14-8-5-3-4-7(12)10(8)17-11/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | HYUSLDMNXPGJSM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide (CID 43311080) is 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide is CN(C)C(=O)CNc1nc2cccc(Cl)c2s1.
What is the InChIKey of 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide?
The InChIKey is HYUSLDMNXPGJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3OS/c1-15(2)9(16)6-13-11-14-8-5-3-4-7(12)10(8)17-11/h3-5H,6H2,1-2H3,(H,13,14).
What are the key properties of 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide?
2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide has a molecular weight of 269.76 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-chloro-1,3-benzothiazol-2-yl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 43311080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).