C11H13NO3S — CID 43311833
2-(3-amino-2-methyl-3-oxopropyl)sulfanylbenzoic acid (PubChem CID 43311833) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(3-amino-2-methyl-3-oxopropyl)sulfanylbenzoic acid.
| Compound Name | 2-(3-amino-2-methyl-3-oxopropyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 43311833 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(3-amino-2-methyl-3-oxopropyl)sulfanylbenzoic acid |
| SMILES | CC(CSc1ccccc1C(=O)O)C(N)=O |
| InChI | InChI=1S/C11H13NO3S/c1-7(10(12)13)6-16-9-5-3-2-4-8(9)11(14)15/h2-5,7H,6H2,1H3,(H2,12,13)(H,14,15) |
| InChIKey | KCFSVJFRHFZJHA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |