C13H16FNO — CID 43312933
2-[ethyl(2-methylprop-2-enyl)amino]-5-fluorobenzaldehyde (PubChem CID 43312933) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is 2-[ethyl(2-methylprop-2-enyl)amino]-5-fluorobenzaldehyde.
| Compound Name | 2-[ethyl(2-methylprop-2-enyl)amino]-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 43312933 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[ethyl(2-methylprop-2-enyl)amino]-5-fluorobenzaldehyde |
| SMILES | C=C(C)CN(CC)c1ccc(F)cc1C=O |
| InChI | InChI=1S/C13H16FNO/c1-4-15(8-10(2)3)13-6-5-12(14)7-11(13)9-16/h5-7,9H,2,4,8H2,1,3H3 |
| InChIKey | YOHQRNBBURWXHX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|