C16H14FNO2S — CID 43313036
(E)-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 43313036) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is (E)-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43313036 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (E)-3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C16H14FNO2S/c17-13-2-3-14(11(9-13)1-4-16(19)20)18-7-5-15-12(10-18)6-8-21-15/h1-4,6,8-9H,5,7,10H2,(H,19,20)/b4-1+ |
| InChIKey | OEMGTOIWNKKNSJ-DAFODLJHSA-N |
| XLogP | 3.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|