C12H18FN3 — CID 43313684
[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methanamine (PubChem CID 43313684) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is [5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methanamine.
| Compound Name | [5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 43313684 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | [5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methanamine |
| SMILES | CN1CCN(c2ccc(F)cc2CN)CC1 |
| InChI | InChI=1S/C12H18FN3/c1-15-4-6-16(7-5-15)12-3-2-11(13)8-10(12)9-14/h2-3,8H,4-7,9,14H2,1H3 |
| InChIKey | AOMZOFLJBIZANN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |