C15H15ClFNO — CID 43314373
[2-(4-chloro-3,5-dimethylphenoxy)-5-fluorophenyl]methanamine (PubChem CID 43314373) has the molecular formula C15H15ClFNO and a molecular weight of 279.74 g/mol. Its IUPAC name is [2-(4-chloro-3,5-dimethylphenoxy)-5-fluorophenyl]methanamine.
| Compound Name | [2-(4-chloro-3,5-dimethylphenoxy)-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 43314373 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | [2-(4-chloro-3,5-dimethylphenoxy)-5-fluorophenyl]methanamine |
| SMILES | Cc1cc(Oc2ccc(F)cc2CN)cc(C)c1Cl |
| InChI | InChI=1S/C15H15ClFNO/c1-9-5-13(6-10(2)15(9)16)19-14-4-3-12(17)7-11(14)8-18/h3-7H,8,18H2,1-2H3 |
| InChIKey | ALJVGYXZUPMILK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |