C17H17ClN2S — CID 43314747
1-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-N-ethylethanamine (PubChem CID 43314747) has the molecular formula C17H17ClN2S and a molecular weight of 316.86 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-N-ethylethanamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 43314747 |
| Molecular Formula | C17H17ClN2S |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccccc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H17ClN2S/c1-2-19-15(11-12-7-3-4-8-13(12)18)17-20-14-9-5-6-10-16(14)21-17/h3-10,15,19H,2,11H2,1H3 |
| InChIKey | MPFGRTTYFWHLRO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |