About 4-(1,3-thiazol-4-yl)benzoic acid
4-(1,3-thiazol-4-yl)benzoic acid (PubChem CID 43314757) has the molecular formula C10H7NO2S
and a molecular weight of 205.24 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(1,3-thiazol-4-yl)benzoic acid |
| PubChem CID | 43314757 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 4-(1,3-thiazol-4-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C10H7NO2S/c12-10(13)8-3-1-7(2-4-8)9-5-14-6-11-9/h1-6H,(H,12,13) |
| InChIKey | DJJLKDMESZPSAM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-thiazol-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazol-4-yl)benzoic acid?
The IUPAC name of 4-(1,3-thiazol-4-yl)benzoic acid (CID 43314757) is 4-(1,3-thiazol-4-yl)benzoic acid.
What is the SMILES notation for 4-(1,3-thiazol-4-yl)benzoic acid?
The canonical SMILES for 4-(1,3-thiazol-4-yl)benzoic acid is O=C(O)c1ccc(-c2cscn2)cc1.
What is the InChIKey of 4-(1,3-thiazol-4-yl)benzoic acid?
The InChIKey is DJJLKDMESZPSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2S/c12-10(13)8-3-1-7(2-4-8)9-5-14-6-11-9/h1-6H,(H,12,13).
What are the key properties of 4-(1,3-thiazol-4-yl)benzoic acid?
4-(1,3-thiazol-4-yl)benzoic acid has a molecular weight of 205.24 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazol-4-yl)benzoic acid is sourced from PubChem (CID 43314757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).